About 3-ethylhexa-1,4-diyne
3-ethylhexa-1,4-diyne (PubChem CID 54278701) has the molecular formula C8H10
and a molecular weight of 106.17 g/mol. Its IUPAC name is 3-ethylhexa-1,4-diyne.
Molecular Properties
| Compound Name | 3-ethylhexa-1,4-diyne |
| PubChem CID | 54278701 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | 3-ethylhexa-1,4-diyne |
| SMILES | C#CC(C#CC)CC |
| InChI | InChI=1S/C8H10/c1-4-7-8(5-2)6-3/h2,8H,6H2,1,3H3 |
| InChIKey | HJCCBDDGTDWQSM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylhexa-1,4-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhexa-1,4-diyne?
The IUPAC name of 3-ethylhexa-1,4-diyne (CID 54278701) is 3-ethylhexa-1,4-diyne.
What is the SMILES notation for 3-ethylhexa-1,4-diyne?
The canonical SMILES for 3-ethylhexa-1,4-diyne is C#CC(C#CC)CC.
What is the InChIKey of 3-ethylhexa-1,4-diyne?
The InChIKey is HJCCBDDGTDWQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10/c1-4-7-8(5-2)6-3/h2,8H,6H2,1,3H3.
What are the key properties of 3-ethylhexa-1,4-diyne?
3-ethylhexa-1,4-diyne has a molecular weight of 106.17 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhexa-1,4-diyne is sourced from PubChem (CID 54278701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).