C14H10F11NO2 — CID 54279259
3-phenyl-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,2-oxazolidin-5-ol (PubChem CID 54279259) has the molecular formula C14H10F11NO2 and a molecular weight of 433.22 g/mol. Its IUPAC name is 3-phenyl-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,2-oxazolidin-5-ol.
| Compound Name | 3-phenyl-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,2-oxazolidin-5-ol |
|---|---|
| PubChem CID | 54279259 |
| Molecular Formula | C14H10F11NO2 |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 3-phenyl-2-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)-1,2-oxazolidin-5-ol |
| SMILES | OC1CC(c2ccccc2)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C14H10F11NO2/c15-10(16,11(17,18)13(21,22)23)12(19,20)14(24,25)26-8(6-9(27)28-26)7-4-2-1-3-5-7/h1-5,8-9,27H,6H2 |
| InChIKey | RPQHRGLTLKZJTA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|