C10H18O6S2 — CID 54279519
(3R,4S,5S,6R)-2-(1,3-dithian-2-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 54279519) has the molecular formula C10H18O6S2 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(1,3-dithian-2-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-2-(1,3-dithian-2-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 54279519 |
| Molecular Formula | C10H18O6S2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (3R,4S,5S,6R)-2-(1,3-dithian-2-yl)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1OC(O)(C2SCCCS2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18O6S2/c11-4-5-6(12)7(13)8(14)10(15,16-5)9-17-2-1-3-18-9/h5-9,11-15H,1-4H2/t5-,6-,7+,8-,10?/m1/s1 |
| InChIKey | RPUUFRWMVJYHPF-WQXQQRIOSA-N |
| XLogP | -1.65 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |