About 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid
1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid (PubChem CID 54279544) has the molecular formula C12H11ClO8S
and a molecular weight of 350.73 g/mol. Its IUPAC name is 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid.
Molecular Properties
| Compound Name | 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid |
| PubChem CID | 54279544 |
| Molecular Formula | C12H11ClO8S |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid |
| SMILES | CC(=O)Oc1cc(Cl)c(C(C=O)S(=O)(=O)O)cc1OC(C)=O |
| InChI | InChI=1S/C12H11ClO8S/c1-6(15)20-10-3-8(12(5-14)22(17,18)19)9(13)4-11(10)21-7(2)16/h3-5,12H,1-2H3,(H,17,18,19) |
| InChIKey | OQORSYUWWCSUDE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid?
The IUPAC name of 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid (CID 54279544) is 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid.
What is the SMILES notation for 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid?
The canonical SMILES for 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid is CC(=O)Oc1cc(Cl)c(C(C=O)S(=O)(=O)O)cc1OC(C)=O.
What is the InChIKey of 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid?
The InChIKey is OQORSYUWWCSUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO8S/c1-6(15)20-10-3-8(12(5-14)22(17,18)19)9(13)4-11(10)21-7(2)16/h3-5,12H,1-2H3,(H,17,18,19).
What are the key properties of 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid?
1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid has a molecular weight of 350.73 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-diacetyloxy-2-chlorophenyl)-2-oxoethanesulfonic acid is sourced from PubChem (CID 54279544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).