C20H35N — CID 54279550
N-(3,7-dimethylocta-2,6-dienyl)-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 54279550) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 54279550 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCNCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H35N/c1-17(2)9-7-11-19(5)13-15-21-16-14-20(6)12-8-10-18(3)4/h9-10,13-14,21H,7-8,11-12,15-16H2,1-6H3 |
| InChIKey | RPVFRRGIMWLKIH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|