C25H42O6 — CID 54280641
methyl 7-[(8R,9R)-8-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 54280641) has the molecular formula C25H42O6 and a molecular weight of 438.61 g/mol. Its IUPAC name is methyl 7-[(8R,9R)-8-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
| Compound Name | methyl 7-[(8R,9R)-8-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
|---|---|
| PubChem CID | 54280641 |
| Molecular Formula | C25H42O6 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | methyl 7-[(8R,9R)-8-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCCC1(C=C[C@H]2CCC3(OCCO3)[C@@H]2CCCCCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C25H42O6/c1-3-4-9-14-24(28-17-18-29-24)15-12-21-13-16-25(30-19-20-31-25)22(21)10-7-5-6-8-11-23(26)27-2/h12,15,21-22H,3-11,13-14,16-20H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | RQNQJFWIHQXZHH-FCHUYYIVSA-N |
| XLogP | 5.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|