C12H3F3O5 — CID 54280985
8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 54280985) has the molecular formula C12H3F3O5 and a molecular weight of 284.14 g/mol. Its IUPAC name is 8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 54280985 |
| Molecular Formula | C12H3F3O5 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 8-(trifluoromethyl)cyclopenta[f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1CC(=O)c2c1cc1c(c2C(F)(F)F)C(=O)OC1=O |
| InChI | InChI=1S/C12H3F3O5/c13-12(14,15)9-7-3(5(16)2-6(7)17)1-4-8(9)11(19)20-10(4)18/h1H,2H2 |
| InChIKey | KLPKYDGKYOWJTP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|