C19H34N2O7P2 — CID 54282175
2,2-bis[di(propan-2-yloxy)phosphoryl]-N-pyridin-2-ylacetamide (PubChem CID 54282175) has the molecular formula C19H34N2O7P2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2,2-bis[di(propan-2-yloxy)phosphoryl]-N-pyridin-2-ylacetamide.
| Compound Name | 2,2-bis[di(propan-2-yloxy)phosphoryl]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 54282175 |
| Molecular Formula | C19H34N2O7P2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2,2-bis[di(propan-2-yloxy)phosphoryl]-N-pyridin-2-ylacetamide |
| SMILES | CC(C)OP(=O)(OC(C)C)C(C(=O)Nc1ccccn1)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C19H34N2O7P2/c1-13(2)25-29(23,26-14(3)4)19(18(22)21-17-11-9-10-12-20-17)30(24,27-15(5)6)28-16(7)8/h9-16,19H,1-8H3,(H,20,21,22) |
| InChIKey | RRNUQBSZMAUFOM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|