About 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione
3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione (PubChem CID 54282373) has the molecular formula C18H10N2O4
and a molecular weight of 318.29 g/mol. Its IUPAC name is 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione |
| PubChem CID | 54282373 |
| Molecular Formula | C18H10N2O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2ccc3ccccc3c2C2=CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C18H10N2O4/c21-14-7-12(17(23)19-14)11-6-5-9-3-1-2-4-10(9)16(11)13-8-15(22)20-18(13)24/h1-8H,(H,19,21,23)(H,20,22,24) |
| InChIKey | RRRNFQJSHAPPDL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione?
The IUPAC name of 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione (CID 54282373) is 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione.
What is the SMILES notation for 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione?
The canonical SMILES for 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione is O=C1C=C(c2ccc3ccccc3c2C2=CC(=O)NC2=O)C(=O)N1.
What is the InChIKey of 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione?
The InChIKey is RRRNFQJSHAPPDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10N2O4/c21-14-7-12(17(23)19-14)11-6-5-9-3-1-2-4-10(9)16(11)13-8-15(22)20-18(13)24/h1-8H,(H,19,21,23)(H,20,22,24).
What are the key properties of 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione?
3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione has a molecular weight of 318.29 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione is sourced from PubChem (CID 54282373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).