C18H10N2O4 — CID 54282373
3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione (PubChem CID 54282373) has the molecular formula C18H10N2O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione.
| Compound Name | 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 54282373 |
| Molecular Formula | C18H10N2O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[1-(2,5-dioxopyrrol-3-yl)naphthalen-2-yl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(c2ccc3ccccc3c2C2=CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C18H10N2O4/c21-14-7-12(17(23)19-14)11-6-5-9-3-1-2-4-10(9)16(11)13-8-15(22)20-18(13)24/h1-8H,(H,19,21,23)(H,20,22,24) |
| InChIKey | RRRNFQJSHAPPDL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|