C22H29N3O2 — CID 54282584
1-[(6aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-2-morpholin-4-ylethanone (PubChem CID 54282584) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[(6aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-2-morpholin-4-ylethanone.
| Compound Name | 1-[(6aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-2-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 54282584 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[(6aR)-4,7-dimethyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinolin-9-yl]-2-morpholin-4-ylethanone |
| SMILES | CN1CC(C(=O)CN2CCOCC2)CC2c3cccc4c3c(cn4C)C[C@H]21 |
| InChI | InChI=1S/C22H29N3O2/c1-23-13-16-11-20-18(17-4-3-5-19(23)22(16)17)10-15(12-24(20)2)21(26)14-25-6-8-27-9-7-25/h3-5,13,15,18,20H,6-12,14H2,1-2H3/t15?,18?,20-/m1/s1 |
| InChIKey | RRVBCOGQWXLOIF-PKUWUEBNSA-N |
| XLogP | 2.04 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|