About 4,4-dimethyl-2-phenyl-2,3-dihydrochromene
4,4-dimethyl-2-phenyl-2,3-dihydrochromene (PubChem CID 54282692) has the molecular formula C17H18O
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4,4-dimethyl-2-phenyl-2,3-dihydrochromene.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-phenyl-2,3-dihydrochromene |
| PubChem CID | 54282692 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4,4-dimethyl-2-phenyl-2,3-dihydrochromene |
| SMILES | CC1(C)CC(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C17H18O/c1-17(2)12-16(13-8-4-3-5-9-13)18-15-11-7-6-10-14(15)17/h3-11,16H,12H2,1-2H3 |
| InChIKey | RRXBLOHBPZGMLW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-dimethyl-2-phenyl-2,3-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-phenyl-2,3-dihydrochromene?
The IUPAC name of 4,4-dimethyl-2-phenyl-2,3-dihydrochromene (CID 54282692) is 4,4-dimethyl-2-phenyl-2,3-dihydrochromene.
What is the SMILES notation for 4,4-dimethyl-2-phenyl-2,3-dihydrochromene?
The canonical SMILES for 4,4-dimethyl-2-phenyl-2,3-dihydrochromene is CC1(C)CC(c2ccccc2)Oc2ccccc21.
What is the InChIKey of 4,4-dimethyl-2-phenyl-2,3-dihydrochromene?
The InChIKey is RRXBLOHBPZGMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O/c1-17(2)12-16(13-8-4-3-5-9-13)18-15-11-7-6-10-14(15)17/h3-11,16H,12H2,1-2H3.
What are the key properties of 4,4-dimethyl-2-phenyl-2,3-dihydrochromene?
4,4-dimethyl-2-phenyl-2,3-dihydrochromene has a molecular weight of 238.33 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-phenyl-2,3-dihydrochromene is sourced from PubChem (CID 54282692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).