C29H23N3O8 — CID 54282835
2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-(3,5,8,10-tetrahydroxy-9-methyl-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl)benzoate (PubChem CID 54282835) has the molecular formula C29H23N3O8 and a molecular weight of 541.52 g/mol. Its IUPAC name is 2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-(3,5,8,10-tetrahydroxy-9-methyl-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl)benzoate.
| Compound Name | 2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-(3,5,8,10-tetrahydroxy-9-methyl-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl)benzoate |
|---|---|
| PubChem CID | 54282835 |
| Molecular Formula | C29H23N3O8 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-(3,5,8,10-tetrahydroxy-9-methyl-4,9-diazatricyclo[5.3.0.02,6]deca-1(10),2,5,7-tetraen-4-yl)benzoate |
| SMILES | Cc1cc(C(=O)OCCN2C(=O)C=C(c3ccccc3)C2=O)cc(-n2c(O)c3c(c2O)-c2c-3c(O)n(C)c2O)c1 |
| InChI | InChI=1S/C29H23N3O8/c1-14-10-16(29(39)40-9-8-31-19(33)13-18(24(31)34)15-6-4-3-5-7-15)12-17(11-14)32-27(37)22-20-21(23(22)28(32)38)26(36)30(2)25(20)35/h3-7,10-13,35-38H,8-9H2,1-2H3 |
| InChIKey | RRZOKCURYMPJMI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|