About 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde
4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde (PubChem CID 54283006) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde.
Molecular Properties
| Compound Name | 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde |
| PubChem CID | 54283006 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde |
| SMILES | C=O.Cc1[nH]c(=O)sc1C |
| InChI | InChI=1S/C5H7NOS.CH2O/c1-3-4(2)8-5(7)6-3;1-2/h1-2H3,(H,6,7);1H2 |
| InChIKey | RSCDHPRHFKBATR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde?
The IUPAC name of 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde (CID 54283006) is 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde.
What is the SMILES notation for 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde?
The canonical SMILES for 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde is C=O.Cc1[nH]c(=O)sc1C.
What is the InChIKey of 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde?
The InChIKey is RSCDHPRHFKBATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS.CH2O/c1-3-4(2)8-5(7)6-3;1-2/h1-2H3,(H,6,7);1H2.
What are the key properties of 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde?
4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde has a molecular weight of 159.21 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3H-1,3-thiazol-2-one;formaldehyde is sourced from PubChem (CID 54283006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).