About 3-(1,3-dioxol-4-yl)-1,3-thiazolidine
3-(1,3-dioxol-4-yl)-1,3-thiazolidine (PubChem CID 54283019) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3-(1,3-dioxol-4-yl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3-(1,3-dioxol-4-yl)-1,3-thiazolidine |
| PubChem CID | 54283019 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3-(1,3-dioxol-4-yl)-1,3-thiazolidine |
| SMILES | C1=C(N2CCSC2)OCO1 |
| InChI | InChI=1S/C6H9NO2S/c1-2-10-4-7(1)6-3-8-5-9-6/h3H,1-2,4-5H2 |
| InChIKey | RSCJUFXTRCZKBK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-dioxol-4-yl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxol-4-yl)-1,3-thiazolidine?
The IUPAC name of 3-(1,3-dioxol-4-yl)-1,3-thiazolidine (CID 54283019) is 3-(1,3-dioxol-4-yl)-1,3-thiazolidine.
What is the SMILES notation for 3-(1,3-dioxol-4-yl)-1,3-thiazolidine?
The canonical SMILES for 3-(1,3-dioxol-4-yl)-1,3-thiazolidine is C1=C(N2CCSC2)OCO1.
What is the InChIKey of 3-(1,3-dioxol-4-yl)-1,3-thiazolidine?
The InChIKey is RSCJUFXTRCZKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c1-2-10-4-7(1)6-3-8-5-9-6/h3H,1-2,4-5H2.
What are the key properties of 3-(1,3-dioxol-4-yl)-1,3-thiazolidine?
3-(1,3-dioxol-4-yl)-1,3-thiazolidine has a molecular weight of 159.21 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxol-4-yl)-1,3-thiazolidine is sourced from PubChem (CID 54283019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).