C34H48O4SSi — CID 54283872
phenyl [(1S,3S,9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfanylformate (PubChem CID 54283872) has the molecular formula C34H48O4SSi and a molecular weight of 580.91 g/mol. Its IUPAC name is phenyl [(1S,3S,9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfanylformate.
| Compound Name | phenyl [(1S,3S,9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfanylformate |
|---|---|
| PubChem CID | 54283872 |
| Molecular Formula | C34H48O4SSi |
| Molecular Weight | 580.91 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | phenyl [(1S,3S,9S,10R,13S,14S)-1-[tert-butyl(dimethyl)silyl]oxy-17-ethyl-3-hydroxy-10,13-dimethyl-1,2,4,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]sulfanylformate |
| SMILES | CCC1=CC[C@H]2C3=CC=C4C[C@](O)(SC(=O)Oc5ccccc5)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H48O4SSi/c1-9-23-16-18-27-26-17-15-24-21-34(36,39-30(35)37-25-13-11-10-12-14-25)22-29(38-40(7,8)31(2,3)4)33(24,6)28(26)19-20-32(23,27)5/h10-17,27-29,36H,9,18-22H2,1-8H3/t27-,28-,29-,32+,33-,34-/m0/s1 |
| InChIKey | RSSIRXQAFXQEKK-BXUCRURNSA-N |
| XLogP | 9.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.91 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|