About 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine
2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine (PubChem CID 54284065) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine.
Molecular Properties
| Compound Name | 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine |
| PubChem CID | 54284065 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine |
| SMILES | COC1=CCC2CC(=CCN)C2=C1 |
| InChI | InChI=1S/C11H15NO/c1-13-10-3-2-8-6-9(4-5-12)11(8)7-10/h3-4,7-8H,2,5-6,12H2,1H3 |
| InChIKey | RSVOTCRADLSFNC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine?
The IUPAC name of 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine (CID 54284065) is 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine.
What is the SMILES notation for 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine?
The canonical SMILES for 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine is COC1=CCC2CC(=CCN)C2=C1.
What is the InChIKey of 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine?
The InChIKey is RSVOTCRADLSFNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-13-10-3-2-8-6-9(4-5-12)11(8)7-10/h3-4,7-8H,2,5-6,12H2,1H3.
What are the key properties of 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine?
2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine has a molecular weight of 177.25 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-7-bicyclo[4.2.0]octa-3,5-dienylidene)ethanamine is sourced from PubChem (CID 54284065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).