About bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane
bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane (PubChem CID 54284397) has the molecular formula C24H25BBr2
and a molecular weight of 484.08 g/mol. Its IUPAC name is bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane.
Molecular Properties
| Compound Name | bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane |
| PubChem CID | 54284397 |
| Molecular Formula | C24H25BBr2 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane |
| SMILES | Cc1cc(C)c(B(c2ccccc2)c2c(C)cc(C)cc2CBr)c(CBr)c1 |
| InChI | InChI=1S/C24H25BBr2/c1-16-10-18(3)23(20(12-16)14-26)25(22-8-6-5-7-9-22)24-19(4)11-17(2)13-21(24)15-27/h5-13H,14-15H2,1-4H3 |
| InChIKey | RTBRYKGIVHCDSY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane?
The IUPAC name of bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane (CID 54284397) is bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane.
What is the SMILES notation for bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane?
The canonical SMILES for bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane is Cc1cc(C)c(B(c2ccccc2)c2c(C)cc(C)cc2CBr)c(CBr)c1.
What is the InChIKey of bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane?
The InChIKey is RTBRYKGIVHCDSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25BBr2/c1-16-10-18(3)23(20(12-16)14-26)25(22-8-6-5-7-9-22)24-19(4)11-17(2)13-21(24)15-27/h5-13H,14-15H2,1-4H3.
What are the key properties of bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane?
bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane has a molecular weight of 484.08 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(bromomethyl)-4,6-dimethylphenyl]-phenylborane is sourced from PubChem (CID 54284397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).