C11H15NO — CID 54284576
5-methyl-1,2,3,8,9,9a-hexahydro-3-benzazepin-4-one (PubChem CID 54284576) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-methyl-1,2,3,8,9,9a-hexahydro-3-benzazepin-4-one.
| Compound Name | 5-methyl-1,2,3,8,9,9a-hexahydro-3-benzazepin-4-one |
|---|---|
| PubChem CID | 54284576 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-methyl-1,2,3,8,9,9a-hexahydro-3-benzazepin-4-one |
| SMILES | CC1=C2C=CCCC2CCNC1=O |
| InChI | InChI=1S/C11H15NO/c1-8-10-5-3-2-4-9(10)6-7-12-11(8)13/h3,5,9H,2,4,6-7H2,1H3,(H,12,13) |
| InChIKey | RTEVVEHXLJWZBV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |