C7H2F12O — CID 542848
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal (PubChem CID 542848) has the molecular formula C7H2F12O and a molecular weight of 330.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal |
|---|---|
| PubChem CID | 542848 |
| Molecular Formula | C7H2F12O |
| Molecular Weight | 330.07 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H2F12O/c8-2(9)4(12,13)6(16,17)7(18,19)5(14,15)3(10,11)1-20/h1-2H |
| InChIKey | NRHPPSVQCZAEGQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.07 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|