C5H2F8O — CID 542849
2,2,3,3,4,4,5,5-octafluoropentanal (PubChem CID 542849) has the molecular formula C5H2F8O and a molecular weight of 230.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentanal.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentanal |
|---|---|
| PubChem CID | 542849 |
| Molecular Formula | C5H2F8O |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentanal |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C5H2F8O/c6-2(7)4(10,11)5(12,13)3(8,9)1-14/h1-2H |
| InChIKey | BQFRALWVZATVGY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|