About 3,4-dibromocyclobutene
3,4-dibromocyclobutene (PubChem CID 542850) has the molecular formula C4H4Br2
and a molecular weight of 211.88 g/mol. Its IUPAC name is 3,4-dibromocyclobutene.
Molecular Properties
| Compound Name | 3,4-dibromocyclobutene |
| PubChem CID | 542850 |
| Molecular Formula | C4H4Br2 |
| Molecular Weight | 211.88 g/mol |
| Exact Mass | 209.87 |
| IUPAC Name | 3,4-dibromocyclobutene |
| SMILES | BrC1C=CC1Br |
| InChI | InChI=1S/C4H4Br2/c5-3-1-2-4(3)6/h1-4H |
| InChIKey | LOUHHAXEVCJWFQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.88 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromocyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromocyclobutene?
The IUPAC name of 3,4-dibromocyclobutene (CID 542850) is 3,4-dibromocyclobutene.
What is the SMILES notation for 3,4-dibromocyclobutene?
The canonical SMILES for 3,4-dibromocyclobutene is BrC1C=CC1Br.
What is the InChIKey of 3,4-dibromocyclobutene?
The InChIKey is LOUHHAXEVCJWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4Br2/c5-3-1-2-4(3)6/h1-4H.
What are the key properties of 3,4-dibromocyclobutene?
3,4-dibromocyclobutene has a molecular weight of 211.88 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromocyclobutene is sourced from PubChem (CID 542850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).