C9H8F6O4 — CID 54285141
4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-methyl 2-methylidenebutanedioate (PubChem CID 54285141) has the molecular formula C9H8F6O4 and a molecular weight of 294.15 g/mol. Its IUPAC name is 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-methyl 2-methylidenebutanedioate.
| Compound Name | 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-methyl 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 54285141 |
| Molecular Formula | C9H8F6O4 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-methyl 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(C(F)(F)F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H8F6O4/c1-4(6(17)18-2)3-5(16)19-7(8(10,11)12)9(13,14)15/h7H,1,3H2,2H3 |
| InChIKey | RTOOLVRATQYQQF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|