About 6,7-diphenyl-1H-pteridine-2,4-dione
6,7-diphenyl-1H-pteridine-2,4-dione (PubChem CID 5428566) has the molecular formula C18H12N4O2
and a molecular weight of 316.32 g/mol. Its IUPAC name is 6,7-diphenyl-1H-pteridine-2,4-dione.
Molecular Properties
| Compound Name | 6,7-diphenyl-1H-pteridine-2,4-dione |
| PubChem CID | 5428566 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 6,7-diphenyl-1H-pteridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2nc(-c3ccccc3)c(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C18H12N4O2/c23-17-15-16(21-18(24)22-17)20-14(12-9-5-2-6-10-12)13(19-15)11-7-3-1-4-8-11/h1-10H,(H2,20,21,22,23,24) |
| InChIKey | GOULKEOXQNZISP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-diphenyl-1H-pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-diphenyl-1H-pteridine-2,4-dione?
The IUPAC name of 6,7-diphenyl-1H-pteridine-2,4-dione (CID 5428566) is 6,7-diphenyl-1H-pteridine-2,4-dione.
What is the SMILES notation for 6,7-diphenyl-1H-pteridine-2,4-dione?
The canonical SMILES for 6,7-diphenyl-1H-pteridine-2,4-dione is O=c1[nH]c(=O)c2nc(-c3ccccc3)c(-c3ccccc3)nc2[nH]1.
What is the InChIKey of 6,7-diphenyl-1H-pteridine-2,4-dione?
The InChIKey is GOULKEOXQNZISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N4O2/c23-17-15-16(21-18(24)22-17)20-14(12-9-5-2-6-10-12)13(19-15)11-7-3-1-4-8-11/h1-10H,(H2,20,21,22,23,24).
What are the key properties of 6,7-diphenyl-1H-pteridine-2,4-dione?
6,7-diphenyl-1H-pteridine-2,4-dione has a molecular weight of 316.32 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-diphenyl-1H-pteridine-2,4-dione is sourced from PubChem (CID 5428566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).