C19H21F4NO2 — CID 54285880
2-(4-tert-butylphenyl)-2-[[hydroxy-(2,3,5,6-tetrafluorophenyl)methyl]amino]ethanol (PubChem CID 54285880) has the molecular formula C19H21F4NO2 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-[[hydroxy-(2,3,5,6-tetrafluorophenyl)methyl]amino]ethanol.
| Compound Name | 2-(4-tert-butylphenyl)-2-[[hydroxy-(2,3,5,6-tetrafluorophenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 54285880 |
| Molecular Formula | C19H21F4NO2 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-[[hydroxy-(2,3,5,6-tetrafluorophenyl)methyl]amino]ethanol |
| SMILES | CC(C)(C)c1ccc(C(CO)NC(O)c2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C19H21F4NO2/c1-19(2,3)11-6-4-10(5-7-11)14(9-25)24-18(26)15-16(22)12(20)8-13(21)17(15)23/h4-8,14,18,24-26H,9H2,1-3H3 |
| InChIKey | QJRFALFSTRGDKK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|