C11H16N2OS — CID 54286093
2-butyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine (PubChem CID 54286093) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-butyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine.
| Compound Name | 2-butyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
|---|---|
| PubChem CID | 54286093 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-butyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
| SMILES | CCCCC1CN=C(N)c2sccc2O1 |
| InChI | InChI=1S/C11H16N2OS/c1-2-3-4-8-7-13-11(12)10-9(14-8)5-6-15-10/h5-6,8H,2-4,7H2,1H3,(H2,12,13) |
| InChIKey | RUFBGXKDNRRLTC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |