C27H43NO3 — CID 54286178
2,6,10,14-tetramethyl-1-morpholin-4-ylnonadeca-2,6,10,14-tetraene-1,18-dione (PubChem CID 54286178) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is 2,6,10,14-tetramethyl-1-morpholin-4-ylnonadeca-2,6,10,14-tetraene-1,18-dione.
| Compound Name | 2,6,10,14-tetramethyl-1-morpholin-4-ylnonadeca-2,6,10,14-tetraene-1,18-dione |
|---|---|
| PubChem CID | 54286178 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 2,6,10,14-tetramethyl-1-morpholin-4-ylnonadeca-2,6,10,14-tetraene-1,18-dione |
| SMILES | CC(=O)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H43NO3/c1-22(11-7-13-24(3)15-9-17-26(5)29)10-6-12-23(2)14-8-16-25(4)27(30)28-18-20-31-21-19-28/h11-12,15-16H,6-10,13-14,17-21H2,1-5H3 |
| InChIKey | RUGNKJFBMAGNCQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|