C34H30N2O5 — CID 54286741
4-[[4-(3-phenyl-2H-phenanthro[9,10-b][1,4]dioxin-3-yl)benzoyl]amino]butylcarbamic acid (PubChem CID 54286741) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is 4-[[4-(3-phenyl-2H-phenanthro[9,10-b][1,4]dioxin-3-yl)benzoyl]amino]butylcarbamic acid.
| Compound Name | 4-[[4-(3-phenyl-2H-phenanthro[9,10-b][1,4]dioxin-3-yl)benzoyl]amino]butylcarbamic acid |
|---|---|
| PubChem CID | 54286741 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 4-[[4-(3-phenyl-2H-phenanthro[9,10-b][1,4]dioxin-3-yl)benzoyl]amino]butylcarbamic acid |
| SMILES | O=C(O)NCCCCNC(=O)c1ccc(C2(c3ccccc3)COc3c(c4ccccc4c4ccccc34)O2)cc1 |
| InChI | InChI=1S/C34H30N2O5/c37-32(35-20-8-9-21-36-33(38)39)23-16-18-25(19-17-23)34(24-10-2-1-3-11-24)22-40-30-28-14-6-4-12-26(28)27-13-5-7-15-29(27)31(30)41-34/h1-7,10-19,36H,8-9,20-22H2,(H,35,37)(H,38,39) |
| InChIKey | RUQFOFSTYUNAQC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|