C14H14FNO2 — CID 54287249
5-(4-fluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-diol (PubChem CID 54287249) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-diol.
| Compound Name | 5-(4-fluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-diol |
|---|---|
| PubChem CID | 54287249 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-(4-fluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-diol |
| SMILES | Oc1[nH]c(O)c2c1CCC(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C14H14FNO2/c15-10-4-1-8(2-5-10)9-3-6-11-12(7-9)14(18)16-13(11)17/h1-2,4-5,9,16-18H,3,6-7H2 |
| InChIKey | RUZUVAOROMSZIL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |