About 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol
1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol (PubChem CID 54287619) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol |
| PubChem CID | 54287619 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol |
| SMILES | C=C(C)c1cc(O)n(C)c1O |
| InChI | InChI=1S/C8H11NO2/c1-5(2)6-4-7(10)9(3)8(6)11/h4,10-11H,1H2,2-3H3 |
| InChIKey | RVGKMOVCVBKNSU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol?
The IUPAC name of 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol (CID 54287619) is 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol.
What is the SMILES notation for 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol?
The canonical SMILES for 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol is C=C(C)c1cc(O)n(C)c1O.
What is the InChIKey of 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol?
The InChIKey is RVGKMOVCVBKNSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5(2)6-4-7(10)9(3)8(6)11/h4,10-11H,1H2,2-3H3.
What are the key properties of 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol?
1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol has a molecular weight of 153.18 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-prop-1-en-2-ylpyrrole-2,5-diol is sourced from PubChem (CID 54287619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).