About naphthalene-1,2,8-tricarbonitrile
naphthalene-1,2,8-tricarbonitrile (PubChem CID 54287628) has the molecular formula C13H5N3
and a molecular weight of 203.20 g/mol. Its IUPAC name is naphthalene-1,2,8-tricarbonitrile.
Molecular Properties
| Compound Name | naphthalene-1,2,8-tricarbonitrile |
| PubChem CID | 54287628 |
| Molecular Formula | C13H5N3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | naphthalene-1,2,8-tricarbonitrile |
| SMILES | N#Cc1ccc2cccc(C#N)c2c1C#N |
| InChI | InChI=1S/C13H5N3/c14-6-10-5-4-9-2-1-3-11(7-15)13(9)12(10)8-16/h1-5H |
| InChIKey | XNTMLBOFHRZZFN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalene-1,2,8-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,2,8-tricarbonitrile?
The IUPAC name of naphthalene-1,2,8-tricarbonitrile (CID 54287628) is naphthalene-1,2,8-tricarbonitrile.
What is the SMILES notation for naphthalene-1,2,8-tricarbonitrile?
The canonical SMILES for naphthalene-1,2,8-tricarbonitrile is N#Cc1ccc2cccc(C#N)c2c1C#N.
What is the InChIKey of naphthalene-1,2,8-tricarbonitrile?
The InChIKey is XNTMLBOFHRZZFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5N3/c14-6-10-5-4-9-2-1-3-11(7-15)13(9)12(10)8-16/h1-5H.
What are the key properties of naphthalene-1,2,8-tricarbonitrile?
naphthalene-1,2,8-tricarbonitrile has a molecular weight of 203.20 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,2,8-tricarbonitrile is sourced from PubChem (CID 54287628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).