About 1-cyclopentyl-1,2-dipropylhydrazine
1-cyclopentyl-1,2-dipropylhydrazine (PubChem CID 54288077) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-cyclopentyl-1,2-dipropylhydrazine.
Molecular Properties
| Compound Name | 1-cyclopentyl-1,2-dipropylhydrazine |
| PubChem CID | 54288077 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-cyclopentyl-1,2-dipropylhydrazine |
| SMILES | CCCNN(CCC)C1CCCC1 |
| InChI | InChI=1S/C11H24N2/c1-3-9-12-13(10-4-2)11-7-5-6-8-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | KKKZQEJOIQPAFT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-1,2-dipropylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-1,2-dipropylhydrazine?
The IUPAC name of 1-cyclopentyl-1,2-dipropylhydrazine (CID 54288077) is 1-cyclopentyl-1,2-dipropylhydrazine.
What is the SMILES notation for 1-cyclopentyl-1,2-dipropylhydrazine?
The canonical SMILES for 1-cyclopentyl-1,2-dipropylhydrazine is CCCNN(CCC)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-1,2-dipropylhydrazine?
The InChIKey is KKKZQEJOIQPAFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-3-9-12-13(10-4-2)11-7-5-6-8-11/h11-12H,3-10H2,1-2H3.
What are the key properties of 1-cyclopentyl-1,2-dipropylhydrazine?
1-cyclopentyl-1,2-dipropylhydrazine has a molecular weight of 184.33 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-1,2-dipropylhydrazine is sourced from PubChem (CID 54288077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).