C10H4F16O — CID 54288252
4-(difluoromethyl)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxypent-2-ene (PubChem CID 54288252) has the molecular formula C10H4F16O and a molecular weight of 444.11 g/mol. Its IUPAC name is 4-(difluoromethyl)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxypent-2-ene.
| Compound Name | 4-(difluoromethyl)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxypent-2-ene |
|---|---|
| PubChem CID | 54288252 |
| Molecular Formula | C10H4F16O |
| Molecular Weight | 444.11 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | 4-(difluoromethyl)-1,1,1,4,5,5,5-heptafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methoxypent-2-ene |
| SMILES | COC(=C(C(F)(C(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F16O/c1-27-3(7(15,16)17)2(5(13,4(11)12)8(18,19)20)6(14,9(21,22)23)10(24,25)26/h4H,1H3 |
| InChIKey | RVRCMZYRBSNRKH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|