C24H36N3O7P — CID 54288270
(4-methoxy-1,3-dioxoisoindol-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid (PubChem CID 54288270) has the molecular formula C24H36N3O7P and a molecular weight of 509.54 g/mol. Its IUPAC name is (4-methoxy-1,3-dioxoisoindol-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid.
| Compound Name | (4-methoxy-1,3-dioxoisoindol-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
|---|---|
| PubChem CID | 54288270 |
| Molecular Formula | C24H36N3O7P |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (4-methoxy-1,3-dioxoisoindol-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
| SMILES | CNC(=O)[C@H](CC(C)C)NC(=O)C(CC(C)C)CP(=O)(O)CN1C(=O)c2cccc(OC)c2C1=O |
| InChI | InChI=1S/C24H36N3O7P/c1-14(2)10-16(21(28)26-18(11-15(3)4)22(29)25-5)12-35(32,33)13-27-23(30)17-8-7-9-19(34-6)20(17)24(27)31/h7-9,14-16,18H,10-13H2,1-6H3,(H,25,29)(H,26,28)(H,32,33)/t16?,18-/m0/s1 |
| InChIKey | RVRLELHZICXMHB-DAFXYXGESA-N |
| XLogP | 2.46 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|