About 3-propan-2-ylchrysene
3-propan-2-ylchrysene (PubChem CID 54288405) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-propan-2-ylchrysene.
Molecular Properties
| Compound Name | 3-propan-2-ylchrysene |
| PubChem CID | 54288405 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-propan-2-ylchrysene |
| SMILES | CC(C)c1ccc2ccc3c4ccccc4ccc3c2c1 |
| InChI | InChI=1S/C21H18/c1-14(2)17-8-7-16-10-11-19-18-6-4-3-5-15(18)9-12-20(19)21(16)13-17/h3-14H,1-2H3 |
| InChIKey | RVUHZWVLBJSMSB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-ylchrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylchrysene?
The IUPAC name of 3-propan-2-ylchrysene (CID 54288405) is 3-propan-2-ylchrysene.
What is the SMILES notation for 3-propan-2-ylchrysene?
The canonical SMILES for 3-propan-2-ylchrysene is CC(C)c1ccc2ccc3c4ccccc4ccc3c2c1.
What is the InChIKey of 3-propan-2-ylchrysene?
The InChIKey is RVUHZWVLBJSMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18/c1-14(2)17-8-7-16-10-11-19-18-6-4-3-5-15(18)9-12-20(19)21(16)13-17/h3-14H,1-2H3.
What are the key properties of 3-propan-2-ylchrysene?
3-propan-2-ylchrysene has a molecular weight of 270.38 g/mol, XLogP of 6.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylchrysene is sourced from PubChem (CID 54288405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).