C24H30N2O3 — CID 54289258
phenyl 4-[(7-acetamido-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexanoate (PubChem CID 54289258) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is phenyl 4-[(7-acetamido-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexanoate.
| Compound Name | phenyl 4-[(7-acetamido-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexanoate |
|---|---|
| PubChem CID | 54289258 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | phenyl 4-[(7-acetamido-1,2,3,4-tetrahydronaphthalen-2-yl)amino]hexanoate |
| SMILES | CCC(CCC(=O)Oc1ccccc1)NC1CCc2ccc(NC(C)=O)cc2C1 |
| InChI | InChI=1S/C24H30N2O3/c1-3-20(13-14-24(28)29-23-7-5-4-6-8-23)26-22-12-10-18-9-11-21(25-17(2)27)15-19(18)16-22/h4-9,11,15,20,22,26H,3,10,12-14,16H2,1-2H3,(H,25,27) |
| InChIKey | RWIOFVYQVZAMKC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|