About dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate
dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate (PubChem CID 54289516) has the molecular formula C34H35O7P
and a molecular weight of 586.62 g/mol. Its IUPAC name is dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate |
| PubChem CID | 54289516 |
| Molecular Formula | C34H35O7P |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate |
| SMILES | CCCCOP(=O)(Cc1ccc(C(=O)OCc2ccccc2)cc1C(=O)OCc1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C34H35O7P/c1-2-3-21-41-42(38,34(37)28-17-11-6-12-18-28)25-30-20-19-29(32(35)39-23-26-13-7-4-8-14-26)22-31(30)33(36)40-24-27-15-9-5-10-16-27/h4-20,22,34,37H,2-3,21,23-25H2,1H3 |
| InChIKey | RWNAXSYGGAGAIW-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate?
The IUPAC name of dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate (CID 54289516) is dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate.
What is the SMILES notation for dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate?
The canonical SMILES for dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate is CCCCOP(=O)(Cc1ccc(C(=O)OCc2ccccc2)cc1C(=O)OCc1ccccc1)C(O)c1ccccc1.
What is the InChIKey of dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate?
The InChIKey is RWNAXSYGGAGAIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H35O7P/c1-2-3-21-41-42(38,34(37)28-17-11-6-12-18-28)25-30-20-19-29(32(35)39-23-26-13-7-4-8-14-26)22-31(30)33(36)40-24-27-15-9-5-10-16-27/h4-20,22,34,37H,2-3,21,23-25H2,1H3.
What are the key properties of dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate?
dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate has a molecular weight of 586.62 g/mol, XLogP of 7.69, 14 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 4-[[butoxy-[hydroxy(phenyl)methyl]phosphoryl]methyl]benzene-1,3-dicarboxylate is sourced from PubChem (CID 54289516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).