C5H6N2O2 — CID 54289729
5-methyl-1-tritiopyrimidine-2,4-dione (PubChem CID 54289729) has the molecular formula C5H6N2O2 and a molecular weight of 128.12 g/mol. Its IUPAC name is 5-methyl-1-tritiopyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-tritiopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54289729 |
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 128.12 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 5-methyl-1-tritiopyrimidine-2,4-dione |
| SMILES | [3H]n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9)/i/hT |
| InChIKey | RWQNBRDOKXIBIV-MNYXATJNSA-N |
| XLogP | -0.63 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.12 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |