About ethyl 2-methylpropanoate;propan-2-ylideneazanide
ethyl 2-methylpropanoate;propan-2-ylideneazanide (PubChem CID 54289731) has the molecular formula C9H18NO2-
and a molecular weight of 172.25 g/mol. Its IUPAC name is ethyl 2-methylpropanoate;propan-2-ylideneazanide.
Molecular Properties
| Compound Name | ethyl 2-methylpropanoate;propan-2-ylideneazanide |
| PubChem CID | 54289731 |
| Molecular Formula | C9H18NO2- |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | ethyl 2-methylpropanoate;propan-2-ylideneazanide |
| SMILES | CC(C)=[N-].CCOC(=O)C(C)C |
| InChI | InChI=1S/C6H12O2.C3H6N/c1-4-8-6(7)5(2)3;1-3(2)4/h5H,4H2,1-3H3;1-2H3/q;-1 |
| InChIKey | RWQNNUQGXMNOAX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 48.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylpropanoate;propan-2-ylideneazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylpropanoate;propan-2-ylideneazanide?
The IUPAC name of ethyl 2-methylpropanoate;propan-2-ylideneazanide (CID 54289731) is ethyl 2-methylpropanoate;propan-2-ylideneazanide.
What is the SMILES notation for ethyl 2-methylpropanoate;propan-2-ylideneazanide?
The canonical SMILES for ethyl 2-methylpropanoate;propan-2-ylideneazanide is CC(C)=[N-].CCOC(=O)C(C)C.
What is the InChIKey of ethyl 2-methylpropanoate;propan-2-ylideneazanide?
The InChIKey is RWQNNUQGXMNOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C3H6N/c1-4-8-6(7)5(2)3;1-3(2)4/h5H,4H2,1-3H3;1-2H3/q;-1.
What are the key properties of ethyl 2-methylpropanoate;propan-2-ylideneazanide?
ethyl 2-methylpropanoate;propan-2-ylideneazanide has a molecular weight of 172.25 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylpropanoate;propan-2-ylideneazanide is sourced from PubChem (CID 54289731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).