About (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate
(2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate (PubChem CID 54290127) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate |
| PubChem CID | 54290127 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate |
| SMILES | O=C(CCCc1ccccc1)On1c(O)ccc1O |
| InChI | InChI=1S/C14H15NO4/c16-12-9-10-13(17)15(12)19-14(18)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,16-17H,4,7-8H2 |
| InChIKey | RWXRTQQSUAZFLJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate (CID 54290127) is (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate is O=C(CCCc1ccccc1)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate?
The InChIKey is RWXRTQQSUAZFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c16-12-9-10-13(17)15(12)19-14(18)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,16-17H,4,7-8H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate?
(2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate has a molecular weight of 261.28 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4-phenylbutanoate is sourced from PubChem (CID 54290127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).