About 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate
2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate (PubChem CID 54290139) has the molecular formula C19H20O4
and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate |
| PubChem CID | 54290139 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate |
| SMILES | COC(C(=O)OCCc1ccccc1)=C(OC)c1ccccc1 |
| InChI | InChI=1S/C19H20O4/c1-21-17(16-11-7-4-8-12-16)18(22-2)19(20)23-14-13-15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | RWXXYHWCGMTXIG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate?
The IUPAC name of 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate (CID 54290139) is 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate.
What is the SMILES notation for 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate?
The canonical SMILES for 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate is COC(C(=O)OCCc1ccccc1)=C(OC)c1ccccc1.
What is the InChIKey of 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate?
The InChIKey is RWXXYHWCGMTXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4/c1-21-17(16-11-7-4-8-12-16)18(22-2)19(20)23-14-13-15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3.
What are the key properties of 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate?
2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate has a molecular weight of 312.37 g/mol, XLogP of 3.43, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2,3-dimethoxy-3-phenylprop-2-enoate is sourced from PubChem (CID 54290139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).