About 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one
1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 54290217) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 54290217 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)C2CCC1(C(N)N)C(=O)C2 |
| InChI | InChI=1S/C10H18N2O/c1-9(2)6-3-4-10(9,8(11)12)7(13)5-6/h6,8H,3-5,11-12H2,1-2H3 |
| InChIKey | RWZDSLXSMAHCMR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one (CID 54290217) is 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one is CC1(C)C2CCC1(C(N)N)C(=O)C2.
What is the InChIKey of 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is RWZDSLXSMAHCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-9(2)6-3-4-10(9,8(11)12)7(13)5-6/h6,8H,3-5,11-12H2,1-2H3.
What are the key properties of 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 182.27 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diaminomethyl)-7,7-dimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 54290217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).