About 3-methyl-5,6-dihydrothiazin-2-amine
3-methyl-5,6-dihydrothiazin-2-amine (PubChem CID 54290326) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is 3-methyl-5,6-dihydrothiazin-2-amine.
Molecular Properties
| Compound Name | 3-methyl-5,6-dihydrothiazin-2-amine |
| PubChem CID | 54290326 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 3-methyl-5,6-dihydrothiazin-2-amine |
| SMILES | CC1=CCCSN1N |
| InChI | InChI=1S/C5H10N2S/c1-5-3-2-4-8-7(5)6/h3H,2,4,6H2,1H3 |
| InChIKey | RXBBVTFJYGKVDD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5,6-dihydrothiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-dihydrothiazin-2-amine?
The IUPAC name of 3-methyl-5,6-dihydrothiazin-2-amine (CID 54290326) is 3-methyl-5,6-dihydrothiazin-2-amine.
What is the SMILES notation for 3-methyl-5,6-dihydrothiazin-2-amine?
The canonical SMILES for 3-methyl-5,6-dihydrothiazin-2-amine is CC1=CCCSN1N.
What is the InChIKey of 3-methyl-5,6-dihydrothiazin-2-amine?
The InChIKey is RXBBVTFJYGKVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S/c1-5-3-2-4-8-7(5)6/h3H,2,4,6H2,1H3.
What are the key properties of 3-methyl-5,6-dihydrothiazin-2-amine?
3-methyl-5,6-dihydrothiazin-2-amine has a molecular weight of 130.22 g/mol, XLogP of 1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-dihydrothiazin-2-amine is sourced from PubChem (CID 54290326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).