C24H33FN2O2 — CID 54291137
2-[4-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54291137) has the molecular formula C24H33FN2O2 and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-[4-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-[4-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54291137 |
| Molecular Formula | C24H33FN2O2 |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-[4-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]butyl]-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCCCN1CCC(Cc3ccc(F)cc3)CC1)CCCC2 |
| InChI | InChI=1S/C24H33FN2O2/c25-20-9-7-18(8-10-20)17-19-11-15-26(16-12-19)13-3-4-14-27-23(28)21-5-1-2-6-22(21)24(27)29/h7-10,19,28-29H,1-6,11-17H2 |
| InChIKey | RXOZRNBXVLZJLG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|