C15H9F4NO2S — CID 54291377
4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1,3-benzoxazole (PubChem CID 54291377) has the molecular formula C15H9F4NO2S and a molecular weight of 343.30 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1,3-benzoxazole.
| Compound Name | 4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 54291377 |
| Molecular Formula | C15H9F4NO2S |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[(4-methoxyphenyl)sulfanylmethyl]-1,3-benzoxazole |
| SMILES | COc1ccc(SCc2nc3c(F)c(F)c(F)c(F)c3o2)cc1 |
| InChI | InChI=1S/C15H9F4NO2S/c1-21-7-2-4-8(5-3-7)23-6-9-20-14-12(18)10(16)11(17)13(19)15(14)22-9/h2-5H,6H2,1H3 |
| InChIKey | RXTBRVYTPUHUNS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|