About 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione
3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione (PubChem CID 54291536) has the molecular formula C10H8N2O5
and a molecular weight of 236.18 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione |
| PubChem CID | 54291536 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione |
| SMILES | O=C1C=C(COCC2=CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C10H8N2O5/c13-7-1-5(9(15)11-7)3-17-4-6-2-8(14)12-10(6)16/h1-2H,3-4H2,(H,11,13,15)(H,12,14,16) |
| InChIKey | RXVKVMVWWUIUSU-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione?
The IUPAC name of 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione (CID 54291536) is 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione.
What is the SMILES notation for 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione?
The canonical SMILES for 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione is O=C1C=C(COCC2=CC(=O)NC2=O)C(=O)N1.
What is the InChIKey of 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione?
The InChIKey is RXVKVMVWWUIUSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O5/c13-7-1-5(9(15)11-7)3-17-4-6-2-8(14)12-10(6)16/h1-2H,3-4H2,(H,11,13,15)(H,12,14,16).
What are the key properties of 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione?
3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione has a molecular weight of 236.18 g/mol, XLogP of -1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-dioxopyrrol-3-yl)methoxymethyl]pyrrole-2,5-dione is sourced from PubChem (CID 54291536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).