C21H23N5OS — CID 5429172
N-[(E)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 5429172) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is N-[(E)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-[(E)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5429172 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[(E)-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | Cc1cccc(C)c1-n1c(C)cc(/C=N/NC(=O)CSc2ncccn2)c1C |
| InChI | InChI=1S/C21H23N5OS/c1-14-7-5-8-15(2)20(14)26-16(3)11-18(17(26)4)12-24-25-19(27)13-28-21-22-9-6-10-23-21/h5-12H,13H2,1-4H3,(H,25,27)/b24-12+ |
| InChIKey | XYVVDKAMLGOENM-WYMPLXKRSA-N |
| XLogP | 3.74 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|