C12H26O4S4 — CID 54291740
2-[2,3,4-tris(2-hydroxyethylsulfanyl)butylsulfanyl]ethanol (PubChem CID 54291740) has the molecular formula C12H26O4S4 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-[2,3,4-tris(2-hydroxyethylsulfanyl)butylsulfanyl]ethanol.
| Compound Name | 2-[2,3,4-tris(2-hydroxyethylsulfanyl)butylsulfanyl]ethanol |
|---|---|
| PubChem CID | 54291740 |
| Molecular Formula | C12H26O4S4 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2-[2,3,4-tris(2-hydroxyethylsulfanyl)butylsulfanyl]ethanol |
| SMILES | OCCSCC(SCCO)C(CSCCO)SCCO |
| InChI | InChI=1S/C12H26O4S4/c13-1-5-17-9-11(19-7-3-15)12(20-8-4-16)10-18-6-2-14/h11-16H,1-10H2 |
| InChIKey | RXZBWLDAXHZNQD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|