About 1-(1,4-dioxin-2-yl)piperazine
1-(1,4-dioxin-2-yl)piperazine (PubChem CID 54291974) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-(1,4-dioxin-2-yl)piperazine.
Molecular Properties
| Compound Name | 1-(1,4-dioxin-2-yl)piperazine |
| PubChem CID | 54291974 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 1-(1,4-dioxin-2-yl)piperazine |
| SMILES | C1=COC(N2CCNCC2)=CO1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-10(4-2-9-1)8-7-11-5-6-12-8/h5-7,9H,1-4H2 |
| InChIKey | RYDJFCVVXKMDJB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,4-dioxin-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dioxin-2-yl)piperazine?
The IUPAC name of 1-(1,4-dioxin-2-yl)piperazine (CID 54291974) is 1-(1,4-dioxin-2-yl)piperazine.
What is the SMILES notation for 1-(1,4-dioxin-2-yl)piperazine?
The canonical SMILES for 1-(1,4-dioxin-2-yl)piperazine is C1=COC(N2CCNCC2)=CO1.
What is the InChIKey of 1-(1,4-dioxin-2-yl)piperazine?
The InChIKey is RYDJFCVVXKMDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-3-10(4-2-9-1)8-7-11-5-6-12-8/h5-7,9H,1-4H2.
What are the key properties of 1-(1,4-dioxin-2-yl)piperazine?
1-(1,4-dioxin-2-yl)piperazine has a molecular weight of 168.20 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxin-2-yl)piperazine is sourced from PubChem (CID 54291974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).