About 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol
3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol (PubChem CID 54292038) has the molecular formula C13H14ClNO2
and a molecular weight of 251.71 g/mol. Its IUPAC name is 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol.
Molecular Properties
| Compound Name | 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol |
| PubChem CID | 54292038 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol |
| SMILES | Cc1cc(Cl)c(-c2c(O)[nH]c(C)c2O)cc1C |
| InChI | InChI=1S/C13H14ClNO2/c1-6-4-9(10(14)5-7(6)2)11-12(16)8(3)15-13(11)17/h4-5,15-17H,1-3H3 |
| InChIKey | RYEIBOMCZSACBE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol?
The IUPAC name of 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol (CID 54292038) is 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol.
What is the SMILES notation for 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol?
The canonical SMILES for 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol is Cc1cc(Cl)c(-c2c(O)[nH]c(C)c2O)cc1C.
What is the InChIKey of 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol?
The InChIKey is RYEIBOMCZSACBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO2/c1-6-4-9(10(14)5-7(6)2)11-12(16)8(3)15-13(11)17/h4-5,15-17H,1-3H3.
What are the key properties of 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol?
3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol has a molecular weight of 251.71 g/mol, XLogP of 3.67, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-4,5-dimethylphenyl)-5-methyl-1H-pyrrole-2,4-diol is sourced from PubChem (CID 54292038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).