About 2-phenyl-1,3-thiazolidin-2-ol
2-phenyl-1,3-thiazolidin-2-ol (PubChem CID 54292280) has the molecular formula C9H11NOS
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-phenyl-1,3-thiazolidin-2-ol.
Molecular Properties
| Compound Name | 2-phenyl-1,3-thiazolidin-2-ol |
| PubChem CID | 54292280 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-phenyl-1,3-thiazolidin-2-ol |
| SMILES | OC1(c2ccccc2)NCCS1 |
| InChI | InChI=1S/C9H11NOS/c11-9(10-6-7-12-9)8-4-2-1-3-5-8/h1-5,10-11H,6-7H2 |
| InChIKey | RYIVRLWJRCHUCL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1,3-thiazolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-thiazolidin-2-ol?
The IUPAC name of 2-phenyl-1,3-thiazolidin-2-ol (CID 54292280) is 2-phenyl-1,3-thiazolidin-2-ol.
What is the SMILES notation for 2-phenyl-1,3-thiazolidin-2-ol?
The canonical SMILES for 2-phenyl-1,3-thiazolidin-2-ol is OC1(c2ccccc2)NCCS1.
What is the InChIKey of 2-phenyl-1,3-thiazolidin-2-ol?
The InChIKey is RYIVRLWJRCHUCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS/c11-9(10-6-7-12-9)8-4-2-1-3-5-8/h1-5,10-11H,6-7H2.
What are the key properties of 2-phenyl-1,3-thiazolidin-2-ol?
2-phenyl-1,3-thiazolidin-2-ol has a molecular weight of 181.26 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-thiazolidin-2-ol is sourced from PubChem (CID 54292280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).